C24H18ClNO3 — CID 28668422
N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-phenylbenzamide (PubChem CID 28668422) has the molecular formula C24H18ClNO3 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-phenylbenzamide.
| Compound Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 28668422 |
| Molecular Formula | C24H18ClNO3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1cc(-c2ccc(CO)o2)ccc1Cl)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18ClNO3/c25-21-12-10-19(23-13-11-20(15-27)29-23)14-22(21)26-24(28)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-14,27H,15H2,(H,26,28) |
| InChIKey | SOZLNLVHCDCNKM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |