C18H13ClFNO3 — CID 28667544
N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-fluorobenzamide (PubChem CID 28667544) has the molecular formula C18H13ClFNO3 and a molecular weight of 345.76 g/mol. Its IUPAC name is N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 28667544 |
| Molecular Formula | C18H13ClFNO3 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1cc(-c2ccc(CO)o2)ccc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C18H13ClFNO3/c19-15-6-4-11(17-7-5-14(10-22)24-17)9-16(15)21-18(23)12-2-1-3-13(20)8-12/h1-9,22H,10H2,(H,21,23) |
| InChIKey | QWPNFRMKMPKHPI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |