C19H13Cl3N2O3S — CID 28687317
2,4-dichloro-N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]benzamide (PubChem CID 28687317) has the molecular formula C19H13Cl3N2O3S and a molecular weight of 455.75 g/mol. Its IUPAC name is 2,4-dichloro-N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 28687317 |
| Molecular Formula | C19H13Cl3N2O3S |
| Molecular Weight | 455.75 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 2,4-dichloro-N-[[2-chloro-5-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(-c2ccc(CO)o2)ccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl3N2O3S/c20-11-2-4-13(15(22)8-11)18(26)24-19(28)23-16-7-10(1-5-14(16)21)17-6-3-12(9-25)27-17/h1-8,25H,9H2,(H2,23,24,26,28) |
| InChIKey | UIVMTZUETUGTNU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|