C17H16ClNO3S — CID 126210364
2-chloro-5-[5-(piperidine-1-carbothioyl)furan-2-yl]benzoic acid (PubChem CID 126210364) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-chloro-5-[5-(piperidine-1-carbothioyl)furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-(piperidine-1-carbothioyl)furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126210364 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-chloro-5-[5-(piperidine-1-carbothioyl)furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C(=S)N3CCCCC3)o2)ccc1Cl |
| InChI | InChI=1S/C17H16ClNO3S/c18-13-5-4-11(10-12(13)17(20)21)14-6-7-15(22-14)16(23)19-8-2-1-3-9-19/h4-7,10H,1-3,8-9H2,(H,20,21) |
| InChIKey | CGHPTWUCGNNAMS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_amide_A(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|