C20H15Cl2NOS — CID 126200993
[5-(3,4-dichlorophenyl)furan-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione (PubChem CID 126200993) has the molecular formula C20H15Cl2NOS and a molecular weight of 388.32 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)furan-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione.
| Compound Name | [5-(3,4-dichlorophenyl)furan-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione |
|---|---|
| PubChem CID | 126200993 |
| Molecular Formula | C20H15Cl2NOS |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | [5-(3,4-dichlorophenyl)furan-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione |
| SMILES | S=C(c1ccc(-c2ccc(Cl)c(Cl)c2)o1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H15Cl2NOS/c21-16-6-5-14(11-17(16)22)18-7-8-19(24-18)20(25)23-10-9-13-3-1-2-4-15(13)12-23/h1-8,11H,9-10,12H2 |
| InChIKey | MCEXZNWCWIYMFQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|