C23H19Cl2NOS — CID 126212441
[4-[(3,4-dichlorophenyl)methoxy]phenyl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione (PubChem CID 126212441) has the molecular formula C23H19Cl2NOS and a molecular weight of 428.38 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methoxy]phenyl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione.
| Compound Name | [4-[(3,4-dichlorophenyl)methoxy]phenyl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione |
|---|---|
| PubChem CID | 126212441 |
| Molecular Formula | C23H19Cl2NOS |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methoxy]phenyl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanethione |
| SMILES | S=C(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H19Cl2NOS/c24-21-10-5-16(13-22(21)25)15-27-20-8-6-18(7-9-20)23(28)26-12-11-17-3-1-2-4-19(17)14-26/h1-10,13H,11-12,14-15H2 |
| InChIKey | WHDYPBIFHONMQD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|