C15H13BrCl2O — CID 174759962
4-[[4-(2-bromoethyl)phenoxy]methyl]-1,2-dichlorobenzene (PubChem CID 174759962) has the molecular formula C15H13BrCl2O and a molecular weight of 360.08 g/mol. Its IUPAC name is 4-[[4-(2-bromoethyl)phenoxy]methyl]-1,2-dichlorobenzene.
| Compound Name | 4-[[4-(2-bromoethyl)phenoxy]methyl]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 174759962 |
| Molecular Formula | C15H13BrCl2O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 4-[[4-(2-bromoethyl)phenoxy]methyl]-1,2-dichlorobenzene |
| SMILES | Clc1ccc(COc2ccc(CCBr)cc2)cc1Cl |
| InChI | InChI=1S/C15H13BrCl2O/c16-8-7-11-1-4-13(5-2-11)19-10-12-3-6-14(17)15(18)9-12/h1-6,9H,7-8,10H2 |
| InChIKey | DOTLLMZOMHEIRJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|