C17H12Cl2O2 — CID 43326484
7-[(3,4-dichlorophenyl)methoxy]naphthalen-2-ol (PubChem CID 43326484) has the molecular formula C17H12Cl2O2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methoxy]naphthalen-2-ol.
| Compound Name | 7-[(3,4-dichlorophenyl)methoxy]naphthalen-2-ol |
|---|---|
| PubChem CID | 43326484 |
| Molecular Formula | C17H12Cl2O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methoxy]naphthalen-2-ol |
| SMILES | Oc1ccc2ccc(OCc3ccc(Cl)c(Cl)c3)cc2c1 |
| InChI | InChI=1S/C17H12Cl2O2/c18-16-6-1-11(7-17(16)19)10-21-15-5-3-12-2-4-14(20)8-13(12)9-15/h1-9,20H,10H2 |
| InChIKey | LVEANYODRDAXFE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |