C19H18O2 — CID 63549894
7-[(3,5-dimethylphenyl)methoxy]naphthalen-2-ol (PubChem CID 63549894) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 7-[(3,5-dimethylphenyl)methoxy]naphthalen-2-ol.
| Compound Name | 7-[(3,5-dimethylphenyl)methoxy]naphthalen-2-ol |
|---|---|
| PubChem CID | 63549894 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 7-[(3,5-dimethylphenyl)methoxy]naphthalen-2-ol |
| SMILES | Cc1cc(C)cc(COc2ccc3ccc(O)cc3c2)c1 |
| InChI | InChI=1S/C19H18O2/c1-13-7-14(2)9-15(8-13)12-21-19-6-4-16-3-5-18(20)10-17(16)11-19/h3-11,20H,12H2,1-2H3 |
| InChIKey | XBRUILNSSOPJOL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |