About 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene
6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene (PubChem CID 158113747) has the molecular formula C29H26O2
and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene.
Molecular Properties
| Compound Name | 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene |
| PubChem CID | 158113747 |
| Molecular Formula | C29H26O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene |
| SMILES | Cc1ccc2cc(O)ccc2c1.Cc1ccc2cc(OCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C18H16O.C11H10O/c1-14-7-8-17-12-18(10-9-16(17)11-14)19-13-15-5-3-2-4-6-15;1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-12H,13H2,1H3;2-7,12H,1H3 |
| InChIKey | FQTDLPWVSJKTEX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene?
The IUPAC name of 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene (CID 158113747) is 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene.
What is the SMILES notation for 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene?
The canonical SMILES for 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene is Cc1ccc2cc(O)ccc2c1.Cc1ccc2cc(OCc3ccccc3)ccc2c1.
What is the InChIKey of 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene?
The InChIKey is FQTDLPWVSJKTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O.C11H10O/c1-14-7-8-17-12-18(10-9-16(17)11-14)19-13-15-5-3-2-4-6-15;1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-12H,13H2,1H3;2-7,12H,1H3.
What are the key properties of 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene?
6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene has a molecular weight of 406.53 g/mol, XLogP of 7.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylnaphthalen-2-ol;2-methyl-6-phenylmethoxynaphthalene is sourced from PubChem (CID 158113747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).