About CID 159499865
CID 159499865 (PubChem CID 159499865) has the molecular formula C11H10BO
and a molecular weight of 169.01 g/mol.
Molecular Properties
| Compound Name | CID 159499865 |
| PubChem CID | 159499865 |
| Molecular Formula | C11H10BO |
| Molecular Weight | 169.01 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cc(O)ccc2c1.[B] |
| InChI | InChI=1S/C11H10O.B/c1-8-2-3-10-7-11(12)5-4-9(10)6-8;/h2-7,12H,1H3; |
| InChIKey | FRRBWWOUWYCEET-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.01 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159499865 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159499865?
The IUPAC name of CID 159499865 (CID 159499865) is not available.
What is the SMILES notation for CID 159499865?
The canonical SMILES for CID 159499865 is Cc1ccc2cc(O)ccc2c1.[B].
What is the InChIKey of CID 159499865?
The InChIKey is FRRBWWOUWYCEET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.B/c1-8-2-3-10-7-11(12)5-4-9(10)6-8;/h2-7,12H,1H3;.
What are the key properties of CID 159499865?
CID 159499865 has a molecular weight of 169.01 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159499865 is sourced from PubChem (CID 159499865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).