About sodium;hydride;naphthalene-2,6-diol
sodium;hydride;naphthalene-2,6-diol (PubChem CID 174639769) has the molecular formula C10H9NaO2
and a molecular weight of 184.17 g/mol. Its IUPAC name is sodium;hydride;naphthalene-2,6-diol.
Molecular Properties
| Compound Name | sodium;hydride;naphthalene-2,6-diol |
| PubChem CID | 174639769 |
| Molecular Formula | C10H9NaO2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | sodium;hydride;naphthalene-2,6-diol |
| SMILES | Oc1ccc2cc(O)ccc2c1.[H-].[Na+] |
| InChI | InChI=1S/C10H8O2.Na.H/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;;/h1-6,11-12H;;/q;+1;-1 |
| InChIKey | TXJURRJIXJFQGB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;naphthalene-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;naphthalene-2,6-diol?
The IUPAC name of sodium;hydride;naphthalene-2,6-diol (CID 174639769) is sodium;hydride;naphthalene-2,6-diol.
What is the SMILES notation for sodium;hydride;naphthalene-2,6-diol?
The canonical SMILES for sodium;hydride;naphthalene-2,6-diol is Oc1ccc2cc(O)ccc2c1.[H-].[Na+].
What is the InChIKey of sodium;hydride;naphthalene-2,6-diol?
The InChIKey is TXJURRJIXJFQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.Na.H/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;;/h1-6,11-12H;;/q;+1;-1.
What are the key properties of sodium;hydride;naphthalene-2,6-diol?
sodium;hydride;naphthalene-2,6-diol has a molecular weight of 184.17 g/mol, XLogP of -0.63, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;naphthalene-2,6-diol is sourced from PubChem (CID 174639769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).