About Bisphenol A
Bisphenol A (PubChem CID 6623) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
Molecular Properties
| Compound Name | Bisphenol A |
| PubChem CID | 6623 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
| InChI | InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3 |
| InChIKey | IISBACLAFKSPIT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 209 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Bisphenol A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bisphenol A?
The IUPAC name of Bisphenol A (CID 6623) is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
What is the SMILES notation for Bisphenol A?
The canonical SMILES for Bisphenol A is CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.
What is the InChIKey of Bisphenol A?
The InChIKey is IISBACLAFKSPIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3.
What are the key properties of Bisphenol A?
Bisphenol A has a molecular weight of 228.29 g/mol, XLogP of 3.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Bisphenol A is sourced from PubChem (CID 6623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).