About 4-(2-hydroxyethyl)phenol
4-(2-hydroxyethyl)phenol (PubChem CID 10393) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)phenol.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)phenol |
| PubChem CID | 10393 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-(2-hydroxyethyl)phenol |
| SMILES | OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2 |
| InChIKey | YCCILVSKPBXVIP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-hydroxyethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)phenol?
The IUPAC name of 4-(2-hydroxyethyl)phenol (CID 10393) is 4-(2-hydroxyethyl)phenol.
What is the SMILES notation for 4-(2-hydroxyethyl)phenol?
The canonical SMILES for 4-(2-hydroxyethyl)phenol is OCCc1ccc(O)cc1.
What is the InChIKey of 4-(2-hydroxyethyl)phenol?
The InChIKey is YCCILVSKPBXVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2.
What are the key properties of 4-(2-hydroxyethyl)phenol?
4-(2-hydroxyethyl)phenol has a molecular weight of 138.17 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)phenol is sourced from PubChem (CID 10393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).