About 2-(hydroxymethyl)phenol
2-(hydroxymethyl)phenol (PubChem CID 5146) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 2-(hydroxymethyl)phenol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)phenol |
| PubChem CID | 5146 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 2-(hydroxymethyl)phenol |
| SMILES | OCc1ccccc1O |
| InChI | InChI=1S/C7H8O2/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2 |
| InChIKey | CQRYARSYNCAZFO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(hydroxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)phenol?
The IUPAC name of 2-(hydroxymethyl)phenol (CID 5146) is 2-(hydroxymethyl)phenol.
What is the SMILES notation for 2-(hydroxymethyl)phenol?
The canonical SMILES for 2-(hydroxymethyl)phenol is OCc1ccccc1O.
What is the InChIKey of 2-(hydroxymethyl)phenol?
The InChIKey is CQRYARSYNCAZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2.
What are the key properties of 2-(hydroxymethyl)phenol?
2-(hydroxymethyl)phenol has a molecular weight of 124.14 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)phenol is sourced from PubChem (CID 5146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).