About 1-Naphthol
1-Naphthol (PubChem CID 7005) has the molecular formula C10H8O
and a molecular weight of 144.17 g/mol. Its IUPAC name is naphthalen-1-ol.
Molecular Properties
| Compound Name | 1-Naphthol |
| PubChem CID | 7005 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | naphthalen-1-ol |
| SMILES | C1=CC=C2C(=C1)C=CC=C2O |
| InChI | InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| InChIKey | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 133 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-Naphthol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Naphthol?
The IUPAC name of 1-Naphthol (CID 7005) is naphthalen-1-ol.
What is the SMILES notation for 1-Naphthol?
The canonical SMILES for 1-Naphthol is C1=CC=C2C(=C1)C=CC=C2O.
What is the InChIKey of 1-Naphthol?
The InChIKey is KJCVRFUGPWSIIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H.
What are the key properties of 1-Naphthol?
1-Naphthol has a molecular weight of 144.17 g/mol, XLogP of 2.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Naphthol is sourced from PubChem (CID 7005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).