About pyren-1-ol
pyren-1-ol (PubChem CID 21387) has the molecular formula C16H10O
and a molecular weight of 218.25 g/mol. Its IUPAC name is pyren-1-ol.
Molecular Properties
| Compound Name | pyren-1-ol |
| PubChem CID | 21387 |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | pyren-1-ol |
| SMILES | Oc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H |
| InChIKey | BIJNHUAPTJVVNQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyren-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyren-1-ol?
The IUPAC name of pyren-1-ol (CID 21387) is pyren-1-ol.
What is the SMILES notation for pyren-1-ol?
The canonical SMILES for pyren-1-ol is Oc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyren-1-ol?
The InChIKey is BIJNHUAPTJVVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H.
What are the key properties of pyren-1-ol?
pyren-1-ol has a molecular weight of 218.25 g/mol, XLogP of 4.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyren-1-ol is sourced from PubChem (CID 21387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).