About 1-Hydroxypyrene
1-Hydroxypyrene (PubChem CID 21387) has the molecular formula C16H10O
and a molecular weight of 218.25 g/mol. Its IUPAC name is pyren-1-ol.
Molecular Properties
| Compound Name | 1-Hydroxypyrene |
| PubChem CID | 21387 |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | pyren-1-ol |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)O |
| InChI | InChI=1S/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H |
| InChIKey | BIJNHUAPTJVVNQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 300 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-Hydroxypyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Hydroxypyrene?
The IUPAC name of 1-Hydroxypyrene (CID 21387) is pyren-1-ol.
What is the SMILES notation for 1-Hydroxypyrene?
The canonical SMILES for 1-Hydroxypyrene is C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)O.
What is the InChIKey of 1-Hydroxypyrene?
The InChIKey is BIJNHUAPTJVVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H.
What are the key properties of 1-Hydroxypyrene?
1-Hydroxypyrene has a molecular weight of 218.25 g/mol, XLogP of 4.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Hydroxypyrene is sourced from PubChem (CID 21387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).