About Carvacrol
Carvacrol (PubChem CID 10364) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methyl-5-propan-2-ylphenol.
Molecular Properties
| Compound Name | Carvacrol |
| PubChem CID | 10364 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-methyl-5-propan-2-ylphenol |
| SMILES | CC1=C(C=C(C=C1)C(C)C)O |
| InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| InChIKey | RECUKUPTGUEGMW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 120 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Carvacrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Carvacrol?
The IUPAC name of Carvacrol (CID 10364) is 2-methyl-5-propan-2-ylphenol.
What is the SMILES notation for Carvacrol?
The canonical SMILES for Carvacrol is CC1=C(C=C(C=C1)C(C)C)O.
What is the InChIKey of Carvacrol?
The InChIKey is RECUKUPTGUEGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3.
What are the key properties of Carvacrol?
Carvacrol has a molecular weight of 150.22 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Carvacrol is sourced from PubChem (CID 10364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).