About 4-nonylphenol
4-nonylphenol (PubChem CID 1752) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-nonylphenol.
Molecular Properties
| Compound Name | 4-nonylphenol |
| PubChem CID | 1752 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3 |
| InChIKey | IGFHQQFPSIBGKE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nonylphenol?
The IUPAC name of 4-nonylphenol (CID 1752) is 4-nonylphenol.
What is the SMILES notation for 4-nonylphenol?
The canonical SMILES for 4-nonylphenol is CCCCCCCCCc1ccc(O)cc1.
What is the InChIKey of 4-nonylphenol?
The InChIKey is IGFHQQFPSIBGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3.
What are the key properties of 4-nonylphenol?
4-nonylphenol has a molecular weight of 220.36 g/mol, XLogP of 4.69, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nonylphenol is sourced from PubChem (CID 1752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).