About ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol
ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol (PubChem CID 143631161) has the molecular formula C25H28O
and a molecular weight of 344.50 g/mol. Its IUPAC name is ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol.
Molecular Properties
| Compound Name | ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol |
| PubChem CID | 143631161 |
| Molecular Formula | C25H28O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol |
| SMILES | CC.CCc1ccc2ccccc2c1.Cc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C12H12.C11H10O.C2H6/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-8-2-3-10-7-11(12)5-4-9(10)6-8;1-2/h3-9H,2H2,1H3;2-7,12H,1H3;1-2H3 |
| InChIKey | AQIUTNQLVWCJMR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol?
The IUPAC name of ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol (CID 143631161) is ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol.
What is the SMILES notation for ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol?
The canonical SMILES for ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol is CC.CCc1ccc2ccccc2c1.Cc1ccc2cc(O)ccc2c1.
What is the InChIKey of ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol?
The InChIKey is AQIUTNQLVWCJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C11H10O.C2H6/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-8-2-3-10-7-11(12)5-4-9(10)6-8;1-2/h3-9H,2H2,1H3;2-7,12H,1H3;1-2H3.
What are the key properties of ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol?
ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol has a molecular weight of 344.50 g/mol, XLogP of 7.28, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylnaphthalene;6-methylnaphthalen-2-ol is sourced from PubChem (CID 143631161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).