About 2-ethylnaphthalene;N-methylmethanamine;hydrochloride
2-ethylnaphthalene;N-methylmethanamine;hydrochloride (PubChem CID 70022653) has the molecular formula C14H20ClN
and a molecular weight of 237.77 g/mol. Its IUPAC name is 2-ethylnaphthalene;N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-ethylnaphthalene;N-methylmethanamine;hydrochloride |
| PubChem CID | 70022653 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-ethylnaphthalene;N-methylmethanamine;hydrochloride |
| SMILES | CCc1ccc2ccccc2c1.CNC.Cl |
| InChI | InChI=1S/C12H12.C2H7N.ClH/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-3-2;/h3-9H,2H2,1H3;3H,1-2H3;1H |
| InChIKey | WATYEDURBBQMAI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylnaphthalene;N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylnaphthalene;N-methylmethanamine;hydrochloride?
The IUPAC name of 2-ethylnaphthalene;N-methylmethanamine;hydrochloride (CID 70022653) is 2-ethylnaphthalene;N-methylmethanamine;hydrochloride.
What is the SMILES notation for 2-ethylnaphthalene;N-methylmethanamine;hydrochloride?
The canonical SMILES for 2-ethylnaphthalene;N-methylmethanamine;hydrochloride is CCc1ccc2ccccc2c1.CNC.Cl.
What is the InChIKey of 2-ethylnaphthalene;N-methylmethanamine;hydrochloride?
The InChIKey is WATYEDURBBQMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C2H7N.ClH/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-3-2;/h3-9H,2H2,1H3;3H,1-2H3;1H.
What are the key properties of 2-ethylnaphthalene;N-methylmethanamine;hydrochloride?
2-ethylnaphthalene;N-methylmethanamine;hydrochloride has a molecular weight of 237.77 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylnaphthalene;N-methylmethanamine;hydrochloride is sourced from PubChem (CID 70022653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).