About 2-ethylnaphthalene;3-methylquinoline
2-ethylnaphthalene;3-methylquinoline (PubChem CID 143066870) has the molecular formula C22H21N
and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-ethylnaphthalene;3-methylquinoline.
Molecular Properties
| Compound Name | 2-ethylnaphthalene;3-methylquinoline |
| PubChem CID | 143066870 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-ethylnaphthalene;3-methylquinoline |
| SMILES | CCc1ccc2ccccc2c1.Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C12H12.C10H9N/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-8-6-9-4-2-3-5-10(9)11-7-8/h3-9H,2H2,1H3;2-7H,1H3 |
| InChIKey | MNKBHERLVBYTDG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylnaphthalene;3-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylnaphthalene;3-methylquinoline?
The IUPAC name of 2-ethylnaphthalene;3-methylquinoline (CID 143066870) is 2-ethylnaphthalene;3-methylquinoline.
What is the SMILES notation for 2-ethylnaphthalene;3-methylquinoline?
The canonical SMILES for 2-ethylnaphthalene;3-methylquinoline is CCc1ccc2ccccc2c1.Cc1cnc2ccccc2c1.
What is the InChIKey of 2-ethylnaphthalene;3-methylquinoline?
The InChIKey is MNKBHERLVBYTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C10H9N/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-8-6-9-4-2-3-5-10(9)11-7-8/h3-9H,2H2,1H3;2-7H,1H3.
What are the key properties of 2-ethylnaphthalene;3-methylquinoline?
2-ethylnaphthalene;3-methylquinoline has a molecular weight of 299.42 g/mol, XLogP of 5.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylnaphthalene;3-methylquinoline is sourced from PubChem (CID 143066870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).