About 3-ethylquinoline;quinoline
3-ethylquinoline;quinoline (PubChem CID 174966721) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-ethylquinoline;quinoline.
Molecular Properties
| Compound Name | 3-ethylquinoline;quinoline |
| PubChem CID | 174966721 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-ethylquinoline;quinoline |
| SMILES | CCc1cnc2ccccc2c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C11H11N.C9H7N/c1-2-9-7-10-5-3-4-6-11(10)12-8-9;1-2-6-9-8(4-1)5-3-7-10-9/h3-8H,2H2,1H3;1-7H |
| InChIKey | RQAIIZQHVKHRHB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylquinoline;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylquinoline;quinoline?
The IUPAC name of 3-ethylquinoline;quinoline (CID 174966721) is 3-ethylquinoline;quinoline.
What is the SMILES notation for 3-ethylquinoline;quinoline?
The canonical SMILES for 3-ethylquinoline;quinoline is CCc1cnc2ccccc2c1.c1ccc2ncccc2c1.
What is the InChIKey of 3-ethylquinoline;quinoline?
The InChIKey is RQAIIZQHVKHRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C9H7N/c1-2-9-7-10-5-3-4-6-11(10)12-8-9;1-2-6-9-8(4-1)5-3-7-10-9/h3-8H,2H2,1H3;1-7H.
What are the key properties of 3-ethylquinoline;quinoline?
3-ethylquinoline;quinoline has a molecular weight of 286.38 g/mol, XLogP of 5.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylquinoline;quinoline is sourced from PubChem (CID 174966721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).