About osmium(2+);quinoline
osmium(2+);quinoline (PubChem CID 158407120) has the molecular formula C9H7NOs+2
and a molecular weight of 319.39 g/mol. Its IUPAC name is osmium(2+);quinoline.
Molecular Properties
| Compound Name | osmium(2+);quinoline |
| PubChem CID | 158407120 |
| Molecular Formula | C9H7NOs+2 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | osmium(2+);quinoline |
| SMILES | [Os+2].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.Os/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H;/q;+2 |
| InChIKey | GYVLPBYEKVLSRC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze osmium(2+);quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of osmium(2+);quinoline?
The IUPAC name of osmium(2+);quinoline (CID 158407120) is osmium(2+);quinoline.
What is the SMILES notation for osmium(2+);quinoline?
The canonical SMILES for osmium(2+);quinoline is [Os+2].c1ccc2ncccc2c1.
What is the InChIKey of osmium(2+);quinoline?
The InChIKey is GYVLPBYEKVLSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.Os/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H;/q;+2.
What are the key properties of osmium(2+);quinoline?
osmium(2+);quinoline has a molecular weight of 319.39 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for osmium(2+);quinoline is sourced from PubChem (CID 158407120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).