About CID 174859636
CID 174859636 (PubChem CID 174859636) has the molecular formula C9H10BN2
and a molecular weight of 157.00 g/mol.
Molecular Properties
| Compound Name | CID 174859636 |
| PubChem CID | 174859636 |
| Molecular Formula | C9H10BN2 |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | — |
| SMILES | N.[B].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.B.H3N/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-7H;;1H3 |
| InChIKey | QRFNFYOQPSKXFC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174859636 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174859636?
The IUPAC name of CID 174859636 (CID 174859636) is not available.
What is the SMILES notation for CID 174859636?
The canonical SMILES for CID 174859636 is N.[B].c1ccc2ncccc2c1.
What is the InChIKey of CID 174859636?
The InChIKey is QRFNFYOQPSKXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.B.H3N/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-7H;;1H3.
What are the key properties of CID 174859636?
CID 174859636 has a molecular weight of 157.00 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174859636 is sourced from PubChem (CID 174859636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).