About quinoline;hydrochloride;hydroiodide
quinoline;hydrochloride;hydroiodide (PubChem CID 161378453) has the molecular formula C9H9ClIN
and a molecular weight of 293.54 g/mol. Its IUPAC name is quinoline;hydrochloride;hydroiodide.
Molecular Properties
| Compound Name | quinoline;hydrochloride;hydroiodide |
| PubChem CID | 161378453 |
| Molecular Formula | C9H9ClIN |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | quinoline;hydrochloride;hydroiodide |
| SMILES | Cl.I.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.ClH.HI/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-7H;2*1H |
| InChIKey | OEAQZWNEQOJMPR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze quinoline;hydrochloride;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;hydrochloride;hydroiodide?
The IUPAC name of quinoline;hydrochloride;hydroiodide (CID 161378453) is quinoline;hydrochloride;hydroiodide.
What is the SMILES notation for quinoline;hydrochloride;hydroiodide?
The canonical SMILES for quinoline;hydrochloride;hydroiodide is Cl.I.c1ccc2ncccc2c1.
What is the InChIKey of quinoline;hydrochloride;hydroiodide?
The InChIKey is OEAQZWNEQOJMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.ClH.HI/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-7H;2*1H.
What are the key properties of quinoline;hydrochloride;hydroiodide?
quinoline;hydrochloride;hydroiodide has a molecular weight of 293.54 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;hydrochloride;hydroiodide is sourced from PubChem (CID 161378453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).