About quinoline;silver
quinoline;silver (PubChem CID 88761492) has the molecular formula C9H7AgN
and a molecular weight of 237.03 g/mol. Its IUPAC name is quinoline;silver.
Molecular Properties
| Compound Name | quinoline;silver |
| PubChem CID | 88761492 |
| Molecular Formula | C9H7AgN |
| Molecular Weight | 237.03 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | quinoline;silver |
| SMILES | [Ag].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.Ag/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H; |
| InChIKey | HFPRLZVKXHTUDM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.03 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze quinoline;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;silver?
The IUPAC name of quinoline;silver (CID 88761492) is quinoline;silver.
What is the SMILES notation for quinoline;silver?
The canonical SMILES for quinoline;silver is [Ag].c1ccc2ncccc2c1.
What is the InChIKey of quinoline;silver?
The InChIKey is HFPRLZVKXHTUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.Ag/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H;.
What are the key properties of quinoline;silver?
quinoline;silver has a molecular weight of 237.03 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;silver is sourced from PubChem (CID 88761492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).