About hydron;quinoline
hydron;quinoline (PubChem CID 131854096) has the molecular formula C9H9N+2
and a molecular weight of 131.18 g/mol. Its IUPAC name is hydron;quinoline.
Molecular Properties
| Compound Name | hydron;quinoline |
| PubChem CID | 131854096 |
| Molecular Formula | C9H9N+2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | hydron;quinoline |
| SMILES | [H+].[H+].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H/p+2 |
| InChIKey | SMWDFEZZVXVKRB-UHFFFAOYSA-P |
| XLogP | 2.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hydron;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;quinoline?
The IUPAC name of hydron;quinoline (CID 131854096) is hydron;quinoline.
What is the SMILES notation for hydron;quinoline?
The canonical SMILES for hydron;quinoline is [H+].[H+].c1ccc2ncccc2c1.
What is the InChIKey of hydron;quinoline?
The InChIKey is SMWDFEZZVXVKRB-UHFFFAOYSA-P. The full InChI is InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H/p+2.
What are the key properties of hydron;quinoline?
hydron;quinoline has a molecular weight of 131.18 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;quinoline is sourced from PubChem (CID 131854096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).