About quinoline;quinoxaline
quinoline;quinoxaline (PubChem CID 66672759) has the molecular formula C17H13N3
and a molecular weight of 259.31 g/mol. Its IUPAC name is quinoline;quinoxaline.
Molecular Properties
| Compound Name | quinoline;quinoxaline |
| PubChem CID | 66672759 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | quinoline;quinoxaline |
| SMILES | c1ccc2ncccc2c1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C9H7N.C8H6N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-8-7(3-1)9-5-6-10-8/h1-7H;1-6H |
| InChIKey | XYVVNRCEUUMOAX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinoline;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;quinoxaline?
The IUPAC name of quinoline;quinoxaline (CID 66672759) is quinoline;quinoxaline.
What is the SMILES notation for quinoline;quinoxaline?
The canonical SMILES for quinoline;quinoxaline is c1ccc2ncccc2c1.c1ccc2nccnc2c1.
What is the InChIKey of quinoline;quinoxaline?
The InChIKey is XYVVNRCEUUMOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H6N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-8-7(3-1)9-5-6-10-8/h1-7H;1-6H.
What are the key properties of quinoline;quinoxaline?
quinoline;quinoxaline has a molecular weight of 259.31 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;quinoxaline is sourced from PubChem (CID 66672759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).