About CID 159709187
CID 159709187 (PubChem CID 159709187) has the molecular formula C9H7MgN
and a molecular weight of 153.47 g/mol.
Molecular Properties
| Compound Name | CID 159709187 |
| PubChem CID | 159709187 |
| Molecular Formula | C9H7MgN |
| Molecular Weight | 153.47 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | — |
| SMILES | [Mg].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H; |
| InChIKey | MYPNFKKWGMMNMA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 159709187 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159709187?
The IUPAC name of CID 159709187 (CID 159709187) is not available.
What is the SMILES notation for CID 159709187?
The canonical SMILES for CID 159709187 is [Mg].c1ccc2ncccc2c1.
What is the InChIKey of CID 159709187?
The InChIKey is MYPNFKKWGMMNMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H;.
What are the key properties of CID 159709187?
CID 159709187 has a molecular weight of 153.47 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159709187 is sourced from PubChem (CID 159709187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).