About quinoline
quinoline (PubChem CID 76974643) has the molecular formula C9H7N
and a molecular weight of 136.11 g/mol. Its IUPAC name is quinoline.
Molecular Properties
| Compound Name | quinoline |
| PubChem CID | 76974643 |
| Molecular Formula | C9H7N |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | quinoline |
| SMILES | c1c[15n][13c]2[13cH][13cH][13cH][13cH][13c]2c1 |
| InChI | InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H/i1+1,2+1,4+1,6+1,8+1,9+1,10+1 |
| InChIKey | SMWDFEZZVXVKRB-IZEVNRKTSA-N |
| XLogP | 2.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline?
The IUPAC name of quinoline (CID 76974643) is quinoline.
What is the SMILES notation for quinoline?
The canonical SMILES for quinoline is c1c[15n][13c]2[13cH][13cH][13cH][13cH][13c]2c1.
What is the InChIKey of quinoline?
The InChIKey is SMWDFEZZVXVKRB-IZEVNRKTSA-N. The full InChI is InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H/i1+1,2+1,4+1,6+1,8+1,9+1,10+1.
What are the key properties of quinoline?
quinoline has a molecular weight of 136.11 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline is sourced from PubChem (CID 76974643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).