About quinoline;titanium;hydrate
quinoline;titanium;hydrate (PubChem CID 174714429) has the molecular formula C9H9NOTi
and a molecular weight of 195.04 g/mol. Its IUPAC name is quinoline;titanium;hydrate.
Molecular Properties
| Compound Name | quinoline;titanium;hydrate |
| PubChem CID | 174714429 |
| Molecular Formula | C9H9NOTi |
| Molecular Weight | 195.04 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | quinoline;titanium;hydrate |
| SMILES | O.[Ti].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.H2O.Ti/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-7H;1H2; |
| InChIKey | AMTKLNGQWWDHSH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.04 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze quinoline;titanium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;titanium;hydrate?
The IUPAC name of quinoline;titanium;hydrate (CID 174714429) is quinoline;titanium;hydrate.
What is the SMILES notation for quinoline;titanium;hydrate?
The canonical SMILES for quinoline;titanium;hydrate is O.[Ti].c1ccc2ncccc2c1.
What is the InChIKey of quinoline;titanium;hydrate?
The InChIKey is AMTKLNGQWWDHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.H2O.Ti/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-7H;1H2;.
What are the key properties of quinoline;titanium;hydrate?
quinoline;titanium;hydrate has a molecular weight of 195.04 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;titanium;hydrate is sourced from PubChem (CID 174714429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).