About quinoline;tetramethylsilane
quinoline;tetramethylsilane (PubChem CID 91292784) has the molecular formula C13H19NSi
and a molecular weight of 217.39 g/mol. Its IUPAC name is quinoline;tetramethylsilane.
Molecular Properties
| Compound Name | quinoline;tetramethylsilane |
| PubChem CID | 91292784 |
| Molecular Formula | C13H19NSi |
| Molecular Weight | 217.39 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | quinoline;tetramethylsilane |
| SMILES | C[Si](C)(C)C.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C4H12Si/c1-2-6-9-8(4-1)5-3-7-10-9;1-5(2,3)4/h1-7H;1-4H3 |
| InChIKey | WHAYOLXHWCYPCG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze quinoline;tetramethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;tetramethylsilane?
The IUPAC name of quinoline;tetramethylsilane (CID 91292784) is quinoline;tetramethylsilane.
What is the SMILES notation for quinoline;tetramethylsilane?
The canonical SMILES for quinoline;tetramethylsilane is C[Si](C)(C)C.c1ccc2ncccc2c1.
What is the InChIKey of quinoline;tetramethylsilane?
The InChIKey is WHAYOLXHWCYPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H12Si/c1-2-6-9-8(4-1)5-3-7-10-9;1-5(2,3)4/h1-7H;1-4H3.
What are the key properties of quinoline;tetramethylsilane?
quinoline;tetramethylsilane has a molecular weight of 217.39 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;tetramethylsilane is sourced from PubChem (CID 91292784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).