About N-methylmethanamine;quinoline
N-methylmethanamine;quinoline (PubChem CID 155742214) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is N-methylmethanamine;quinoline.
Molecular Properties
| Compound Name | N-methylmethanamine;quinoline |
| PubChem CID | 155742214 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-methylmethanamine;quinoline |
| SMILES | CNC.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H7N/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h1-7H;3H,1-2H3 |
| InChIKey | BCAUITQWDYLYKA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylmethanamine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;quinoline?
The IUPAC name of N-methylmethanamine;quinoline (CID 155742214) is N-methylmethanamine;quinoline.
What is the SMILES notation for N-methylmethanamine;quinoline?
The canonical SMILES for N-methylmethanamine;quinoline is CNC.c1ccc2ncccc2c1.
What is the InChIKey of N-methylmethanamine;quinoline?
The InChIKey is BCAUITQWDYLYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H7N/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h1-7H;3H,1-2H3.
What are the key properties of N-methylmethanamine;quinoline?
N-methylmethanamine;quinoline has a molecular weight of 174.25 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;quinoline is sourced from PubChem (CID 155742214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).