About N,N-dimethylmethanamine;quinoline
N,N-dimethylmethanamine;quinoline (PubChem CID 174404526) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is N,N-dimethylmethanamine;quinoline.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;quinoline |
| PubChem CID | 174404526 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N,N-dimethylmethanamine;quinoline |
| SMILES | CN(C)C.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C3H9N/c1-2-6-9-8(4-1)5-3-7-10-9;1-4(2)3/h1-7H;1-3H3 |
| InChIKey | IWHGECBNOYJKQQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylmethanamine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;quinoline?
The IUPAC name of N,N-dimethylmethanamine;quinoline (CID 174404526) is N,N-dimethylmethanamine;quinoline.
What is the SMILES notation for N,N-dimethylmethanamine;quinoline?
The canonical SMILES for N,N-dimethylmethanamine;quinoline is CN(C)C.c1ccc2ncccc2c1.
What is the InChIKey of N,N-dimethylmethanamine;quinoline?
The InChIKey is IWHGECBNOYJKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H9N/c1-2-6-9-8(4-1)5-3-7-10-9;1-4(2)3/h1-7H;1-3H3.
What are the key properties of N,N-dimethylmethanamine;quinoline?
N,N-dimethylmethanamine;quinoline has a molecular weight of 188.27 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;quinoline is sourced from PubChem (CID 174404526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).