About ethane;methanol;quinoline
ethane;methanol;quinoline (PubChem CID 90686502) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is ethane;methanol;quinoline.
Molecular Properties
| Compound Name | ethane;methanol;quinoline |
| PubChem CID | 90686502 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | ethane;methanol;quinoline |
| SMILES | CC.CO.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H6.CH4O/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2/h1-7H;1-2H3;2H,1H3 |
| InChIKey | RVJGDURDVIDOBL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanol;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;quinoline?
The IUPAC name of ethane;methanol;quinoline (CID 90686502) is ethane;methanol;quinoline.
What is the SMILES notation for ethane;methanol;quinoline?
The canonical SMILES for ethane;methanol;quinoline is CC.CO.c1ccc2ncccc2c1.
What is the InChIKey of ethane;methanol;quinoline?
The InChIKey is RVJGDURDVIDOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H6.CH4O/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2/h1-7H;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;quinoline?
ethane;methanol;quinoline has a molecular weight of 191.27 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;quinoline is sourced from PubChem (CID 90686502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).