About tetrakis(benzene-1,4-diol);quinoline
tetrakis(benzene-1,4-diol);quinoline (PubChem CID 174523855) has the molecular formula C33H31NO8
and a molecular weight of 569.61 g/mol. Its IUPAC name is tetrakis(benzene-1,4-diol);quinoline.
Molecular Properties
| Compound Name | tetrakis(benzene-1,4-diol);quinoline |
| PubChem CID | 174523855 |
| Molecular Formula | C33H31NO8 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | tetrakis(benzene-1,4-diol);quinoline |
| SMILES | Oc1ccc(O)cc1.Oc1ccc(O)cc1.Oc1ccc(O)cc1.Oc1ccc(O)cc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.4C6H6O2/c1-2-6-9-8(4-1)5-3-7-10-9;4*7-5-1-2-6(8)4-3-5/h1-7H;4*1-4,7-8H |
| InChIKey | MAAIJLWHNPAYFH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(benzene-1,4-diol);quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(benzene-1,4-diol);quinoline?
The IUPAC name of tetrakis(benzene-1,4-diol);quinoline (CID 174523855) is tetrakis(benzene-1,4-diol);quinoline.
What is the SMILES notation for tetrakis(benzene-1,4-diol);quinoline?
The canonical SMILES for tetrakis(benzene-1,4-diol);quinoline is Oc1ccc(O)cc1.Oc1ccc(O)cc1.Oc1ccc(O)cc1.Oc1ccc(O)cc1.c1ccc2ncccc2c1.
What is the InChIKey of tetrakis(benzene-1,4-diol);quinoline?
The InChIKey is MAAIJLWHNPAYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.4C6H6O2/c1-2-6-9-8(4-1)5-3-7-10-9;4*7-5-1-2-6(8)4-3-5/h1-7H;4*1-4,7-8H.
What are the key properties of tetrakis(benzene-1,4-diol);quinoline?
tetrakis(benzene-1,4-diol);quinoline has a molecular weight of 569.61 g/mol, XLogP of 6.63, 0 rotatable bonds, 8 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(benzene-1,4-diol);quinoline is sourced from PubChem (CID 174523855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).