About N,N-dimethylaniline;quinoline
N,N-dimethylaniline;quinoline (PubChem CID 70437285) has the molecular formula C17H18N2
and a molecular weight of 250.35 g/mol. Its IUPAC name is N,N-dimethylaniline;quinoline.
Molecular Properties
| Compound Name | N,N-dimethylaniline;quinoline |
| PubChem CID | 70437285 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N,N-dimethylaniline;quinoline |
| SMILES | CN(C)c1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H11N/c1-2-6-9-8(4-1)5-3-7-10-9;1-9(2)8-6-4-3-5-7-8/h1-7H;3-7H,1-2H3 |
| InChIKey | IMLZGYMPPBHYQK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylaniline;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;quinoline?
The IUPAC name of N,N-dimethylaniline;quinoline (CID 70437285) is N,N-dimethylaniline;quinoline.
What is the SMILES notation for N,N-dimethylaniline;quinoline?
The canonical SMILES for N,N-dimethylaniline;quinoline is CN(C)c1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of N,N-dimethylaniline;quinoline?
The InChIKey is IMLZGYMPPBHYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H11N/c1-2-6-9-8(4-1)5-3-7-10-9;1-9(2)8-6-4-3-5-7-8/h1-7H;3-7H,1-2H3.
What are the key properties of N,N-dimethylaniline;quinoline?
N,N-dimethylaniline;quinoline has a molecular weight of 250.35 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;quinoline is sourced from PubChem (CID 70437285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).