About ethane;ethylbenzene;6-ethylquinoline
ethane;ethylbenzene;6-ethylquinoline (PubChem CID 143817758) has the molecular formula C21H27N
and a molecular weight of 293.45 g/mol. Its IUPAC name is ethane;ethylbenzene;6-ethylquinoline.
Molecular Properties
| Compound Name | ethane;ethylbenzene;6-ethylquinoline |
| PubChem CID | 143817758 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | ethane;ethylbenzene;6-ethylquinoline |
| SMILES | CC.CCc1ccc2ncccc2c1.CCc1ccccc1 |
| InChI | InChI=1S/C11H11N.C8H10.C2H6/c1-2-9-5-6-11-10(8-9)4-3-7-12-11;1-2-8-6-4-3-5-7-8;1-2/h3-8H,2H2,1H3;3-7H,2H2,1H3;1-2H3 |
| InChIKey | WJBJRCQBCRVYEC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;ethylbenzene;6-ethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylbenzene;6-ethylquinoline?
The IUPAC name of ethane;ethylbenzene;6-ethylquinoline (CID 143817758) is ethane;ethylbenzene;6-ethylquinoline.
What is the SMILES notation for ethane;ethylbenzene;6-ethylquinoline?
The canonical SMILES for ethane;ethylbenzene;6-ethylquinoline is CC.CCc1ccc2ncccc2c1.CCc1ccccc1.
What is the InChIKey of ethane;ethylbenzene;6-ethylquinoline?
The InChIKey is WJBJRCQBCRVYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C8H10.C2H6/c1-2-9-5-6-11-10(8-9)4-3-7-12-11;1-2-8-6-4-3-5-7-8;1-2/h3-8H,2H2,1H3;3-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethylbenzene;6-ethylquinoline?
ethane;ethylbenzene;6-ethylquinoline has a molecular weight of 293.45 g/mol, XLogP of 6.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylbenzene;6-ethylquinoline is sourced from PubChem (CID 143817758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).