About ethane;ethylbenzene;quinoline
ethane;ethylbenzene;quinoline (PubChem CID 143401699) has the molecular formula C21H29N
and a molecular weight of 295.47 g/mol. Its IUPAC name is ethane;ethylbenzene;quinoline.
Molecular Properties
| Compound Name | ethane;ethylbenzene;quinoline |
| PubChem CID | 143401699 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | ethane;ethylbenzene;quinoline |
| SMILES | CC.CC.CCc1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H10.2C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-8-6-4-3-5-7-8;2*1-2/h1-7H;3-7H,2H2,1H3;2*1-2H3 |
| InChIKey | XAMWADPMADBMBY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;ethylbenzene;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylbenzene;quinoline?
The IUPAC name of ethane;ethylbenzene;quinoline (CID 143401699) is ethane;ethylbenzene;quinoline.
What is the SMILES notation for ethane;ethylbenzene;quinoline?
The canonical SMILES for ethane;ethylbenzene;quinoline is CC.CC.CCc1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of ethane;ethylbenzene;quinoline?
The InChIKey is XAMWADPMADBMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H10.2C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-8-6-4-3-5-7-8;2*1-2/h1-7H;3-7H,2H2,1H3;2*1-2H3.
What are the key properties of ethane;ethylbenzene;quinoline?
ethane;ethylbenzene;quinoline has a molecular weight of 295.47 g/mol, XLogP of 6.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylbenzene;quinoline is sourced from PubChem (CID 143401699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).