About benzylbenzene;quinoline
benzylbenzene;quinoline (PubChem CID 157081554) has the molecular formula C22H19N
and a molecular weight of 297.40 g/mol. Its IUPAC name is benzylbenzene;quinoline.
Molecular Properties
| Compound Name | benzylbenzene;quinoline |
| PubChem CID | 157081554 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | benzylbenzene;quinoline |
| SMILES | c1ccc(Cc2ccccc2)cc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H12.C9H7N/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-6-9-8(4-1)5-3-7-10-9/h1-10H,11H2;1-7H |
| InChIKey | ADPJTVOXDVDLGB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzylbenzene;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;quinoline?
The IUPAC name of benzylbenzene;quinoline (CID 157081554) is benzylbenzene;quinoline.
What is the SMILES notation for benzylbenzene;quinoline?
The canonical SMILES for benzylbenzene;quinoline is c1ccc(Cc2ccccc2)cc1.c1ccc2ncccc2c1.
What is the InChIKey of benzylbenzene;quinoline?
The InChIKey is ADPJTVOXDVDLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C9H7N/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-6-9-8(4-1)5-3-7-10-9/h1-10H,11H2;1-7H.
What are the key properties of benzylbenzene;quinoline?
benzylbenzene;quinoline has a molecular weight of 297.40 g/mol, XLogP of 5.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;quinoline is sourced from PubChem (CID 157081554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).