About ethane;2-ethylnaphthalene
ethane;2-ethylnaphthalene (PubChem CID 90684887) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;2-ethylnaphthalene.
Molecular Properties
| Compound Name | ethane;2-ethylnaphthalene |
| PubChem CID | 90684887 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | ethane;2-ethylnaphthalene |
| SMILES | CC.CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H12.C2H6/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-2/h3-9H,2H2,1H3;1-2H3 |
| InChIKey | IOKWJMOGYHIKKB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-ethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylnaphthalene?
The IUPAC name of ethane;2-ethylnaphthalene (CID 90684887) is ethane;2-ethylnaphthalene.
What is the SMILES notation for ethane;2-ethylnaphthalene?
The canonical SMILES for ethane;2-ethylnaphthalene is CC.CCc1ccc2ccccc2c1.
What is the InChIKey of ethane;2-ethylnaphthalene?
The InChIKey is IOKWJMOGYHIKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C2H6/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;1-2/h3-9H,2H2,1H3;1-2H3.
What are the key properties of ethane;2-ethylnaphthalene?
ethane;2-ethylnaphthalene has a molecular weight of 186.30 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylnaphthalene is sourced from PubChem (CID 90684887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).