About 3-methylquinoline;pentane
3-methylquinoline;pentane (PubChem CID 145470784) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-methylquinoline;pentane.
Molecular Properties
| Compound Name | 3-methylquinoline;pentane |
| PubChem CID | 145470784 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-methylquinoline;pentane |
| SMILES | CCCCC.Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H9N.C5H12/c1-8-6-9-4-2-3-5-10(9)11-7-8;1-3-5-4-2/h2-7H,1H3;3-5H2,1-2H3 |
| InChIKey | JPOGQOUGMKLRDP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylquinoline;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylquinoline;pentane?
The IUPAC name of 3-methylquinoline;pentane (CID 145470784) is 3-methylquinoline;pentane.
What is the SMILES notation for 3-methylquinoline;pentane?
The canonical SMILES for 3-methylquinoline;pentane is CCCCC.Cc1cnc2ccccc2c1.
What is the InChIKey of 3-methylquinoline;pentane?
The InChIKey is JPOGQOUGMKLRDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C5H12/c1-8-6-9-4-2-3-5-10(9)11-7-8;1-3-5-4-2/h2-7H,1H3;3-5H2,1-2H3.
What are the key properties of 3-methylquinoline;pentane?
3-methylquinoline;pentane has a molecular weight of 215.34 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylquinoline;pentane is sourced from PubChem (CID 145470784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).