About 3-butylsulfanylquinoline
3-butylsulfanylquinoline (PubChem CID 118174551) has the molecular formula C13H15NS
and a molecular weight of 217.34 g/mol. Its IUPAC name is 3-butylsulfanylquinoline.
Molecular Properties
| Compound Name | 3-butylsulfanylquinoline |
| PubChem CID | 118174551 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-butylsulfanylquinoline |
| SMILES | CCCCSc1cnc2ccccc2c1 |
| InChI | InChI=1S/C13H15NS/c1-2-3-8-15-12-9-11-6-4-5-7-13(11)14-10-12/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | BWCQSZFPKISQKB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butylsulfanylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylsulfanylquinoline?
The IUPAC name of 3-butylsulfanylquinoline (CID 118174551) is 3-butylsulfanylquinoline.
What is the SMILES notation for 3-butylsulfanylquinoline?
The canonical SMILES for 3-butylsulfanylquinoline is CCCCSc1cnc2ccccc2c1.
What is the InChIKey of 3-butylsulfanylquinoline?
The InChIKey is BWCQSZFPKISQKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NS/c1-2-3-8-15-12-9-11-6-4-5-7-13(11)14-10-12/h4-7,9-10H,2-3,8H2,1H3.
What are the key properties of 3-butylsulfanylquinoline?
3-butylsulfanylquinoline has a molecular weight of 217.34 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylsulfanylquinoline is sourced from PubChem (CID 118174551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).