About acridine;heptane
acridine;heptane (PubChem CID 158562494) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is acridine;heptane.
Molecular Properties
| Compound Name | acridine;heptane |
| PubChem CID | 158562494 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | acridine;heptane |
| SMILES | CCCCCCC.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C7H16/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-3-5-7-6-4-2/h1-9H;3-7H2,1-2H3 |
| InChIKey | HRBDKLNNZHOLKJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;heptane?
The IUPAC name of acridine;heptane (CID 158562494) is acridine;heptane.
What is the SMILES notation for acridine;heptane?
The canonical SMILES for acridine;heptane is CCCCCCC.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;heptane?
The InChIKey is HRBDKLNNZHOLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C7H16/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-3-5-7-6-4-2/h1-9H;3-7H2,1-2H3.
What are the key properties of acridine;heptane?
acridine;heptane has a molecular weight of 279.43 g/mol, XLogP of 6.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;heptane is sourced from PubChem (CID 158562494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).