About acridine;methane
acridine;methane (PubChem CID 21324126) has the molecular formula C14H13N
and a molecular weight of 195.26 g/mol. Its IUPAC name is acridine;methane.
Molecular Properties
| Compound Name | acridine;methane |
| PubChem CID | 21324126 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | acridine;methane |
| SMILES | C.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-9H;1H4 |
| InChIKey | MIHMCYNRHHJLSK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;methane?
The IUPAC name of acridine;methane (CID 21324126) is acridine;methane.
What is the SMILES notation for acridine;methane?
The canonical SMILES for acridine;methane is C.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;methane?
The InChIKey is MIHMCYNRHHJLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.CH4/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-9H;1H4.
What are the key properties of acridine;methane?
acridine;methane has a molecular weight of 195.26 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;methane is sourced from PubChem (CID 21324126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).