About acridine;sulfane
acridine;sulfane (PubChem CID 159134653) has the molecular formula C13H11NS
and a molecular weight of 213.31 g/mol. Its IUPAC name is acridine;sulfane.
Molecular Properties
| Compound Name | acridine;sulfane |
| PubChem CID | 159134653 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | acridine;sulfane |
| SMILES | S.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.H2S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-9H;1H2 |
| InChIKey | MQPYDIWWMSVMFW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;sulfane?
The IUPAC name of acridine;sulfane (CID 159134653) is acridine;sulfane.
What is the SMILES notation for acridine;sulfane?
The canonical SMILES for acridine;sulfane is S.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;sulfane?
The InChIKey is MQPYDIWWMSVMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.H2S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-9H;1H2.
What are the key properties of acridine;sulfane?
acridine;sulfane has a molecular weight of 213.31 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;sulfane is sourced from PubChem (CID 159134653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).