About acridine;dihydrate
acridine;dihydrate (PubChem CID 172843020) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is acridine;dihydrate.
Molecular Properties
| Compound Name | acridine;dihydrate |
| PubChem CID | 172843020 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | acridine;dihydrate |
| SMILES | O.O.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.2H2O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;;/h1-9H;2*1H2 |
| InChIKey | XAZJHFNDBRWANZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;dihydrate?
The IUPAC name of acridine;dihydrate (CID 172843020) is acridine;dihydrate.
What is the SMILES notation for acridine;dihydrate?
The canonical SMILES for acridine;dihydrate is O.O.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;dihydrate?
The InChIKey is XAZJHFNDBRWANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.2H2O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;;/h1-9H;2*1H2.
What are the key properties of acridine;dihydrate?
acridine;dihydrate has a molecular weight of 215.25 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;dihydrate is sourced from PubChem (CID 172843020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).