About acridine;ethane
acridine;ethane (PubChem CID 123684759) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is acridine;ethane.
Molecular Properties
| Compound Name | acridine;ethane |
| PubChem CID | 123684759 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | acridine;ethane |
| SMILES | CC.CC.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.2C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;2*1-2/h1-9H;2*1-2H3 |
| InChIKey | DXBFKTBSVUKVDD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;ethane?
The IUPAC name of acridine;ethane (CID 123684759) is acridine;ethane.
What is the SMILES notation for acridine;ethane?
The canonical SMILES for acridine;ethane is CC.CC.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;ethane?
The InChIKey is DXBFKTBSVUKVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.2C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;2*1-2/h1-9H;2*1-2H3.
What are the key properties of acridine;ethane?
acridine;ethane has a molecular weight of 239.36 g/mol, XLogP of 5.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;ethane is sourced from PubChem (CID 123684759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).