About 3H-acridin-3-ide;praseodymium
3H-acridin-3-ide;praseodymium (PubChem CID 172620729) has the molecular formula C13H8NPr-
and a molecular weight of 319.12 g/mol. Its IUPAC name is 3H-acridin-3-ide;praseodymium.
Molecular Properties
| Compound Name | 3H-acridin-3-ide;praseodymium |
| PubChem CID | 172620729 |
| Molecular Formula | C13H8NPr- |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 3H-acridin-3-ide;praseodymium |
| SMILES | [Pr].[c-]1ccc2cc3ccccc3nc2c1 |
| InChI | InChI=1S/C13H8N.Pr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-3,5-9H;/q-1; |
| InChIKey | DHZVJKVPNIPSKM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3H-acridin-3-ide;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-acridin-3-ide;praseodymium?
The IUPAC name of 3H-acridin-3-ide;praseodymium (CID 172620729) is 3H-acridin-3-ide;praseodymium.
What is the SMILES notation for 3H-acridin-3-ide;praseodymium?
The canonical SMILES for 3H-acridin-3-ide;praseodymium is [Pr].[c-]1ccc2cc3ccccc3nc2c1.
What is the InChIKey of 3H-acridin-3-ide;praseodymium?
The InChIKey is DHZVJKVPNIPSKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N.Pr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;/h1-3,5-9H;/q-1;.
What are the key properties of 3H-acridin-3-ide;praseodymium?
3H-acridin-3-ide;praseodymium has a molecular weight of 319.12 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-acridin-3-ide;praseodymium is sourced from PubChem (CID 172620729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).